C20H27N5O7S3 — CID 143699394
[2-(nitrosooxymethyl)phenyl] N-[[4-[amino(ethyl)amino]-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfanyl]carbamate (PubChem CID 143699394) has the molecular formula C20H27N5O7S3 and a molecular weight of 545.67 g/mol. Its IUPAC name is [2-(nitrosooxymethyl)phenyl] N-[[4-[amino(ethyl)amino]-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfanyl]carbamate.
| Compound Name | [2-(nitrosooxymethyl)phenyl] N-[[4-[amino(ethyl)amino]-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfanyl]carbamate |
|---|---|
| PubChem CID | 143699394 |
| Molecular Formula | C20H27N5O7S3 |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | [2-(nitrosooxymethyl)phenyl] N-[[4-[amino(ethyl)amino]-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfanyl]carbamate |
| SMILES | CCN(N)C1CN(CCCOC)S(=O)(=O)c2sc(SNC(=O)Oc3ccccc3CON=O)cc21 |
| InChI | InChI=1S/C20H27N5O7S3/c1-3-25(21)16-12-24(9-6-10-30-2)35(28,29)19-15(16)11-18(33-19)34-22-20(26)32-17-8-5-4-7-14(17)13-31-23-27/h4-5,7-8,11,16H,3,6,9-10,12-13,21H2,1-2H3,(H,22,26) |
| InChIKey | DJBSAMANKMIUKD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|