C21H30N4O7S3 — CID 143699351
[3-[[6-(1-aminosulfanylethenylsulfanyl)-2-(3-methoxypropyl)-5-methyl-1,1-dioxo-3,4-dihydrothiazin-4-yl]-ethylcarbamoyl]phenyl]methyl nitrate (PubChem CID 143699351) has the molecular formula C21H30N4O7S3 and a molecular weight of 546.69 g/mol. Its IUPAC name is [3-[[6-(1-aminosulfanylethenylsulfanyl)-2-(3-methoxypropyl)-5-methyl-1,1-dioxo-3,4-dihydrothiazin-4-yl]-ethylcarbamoyl]phenyl]methyl nitrate.
| Compound Name | [3-[[6-(1-aminosulfanylethenylsulfanyl)-2-(3-methoxypropyl)-5-methyl-1,1-dioxo-3,4-dihydrothiazin-4-yl]-ethylcarbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 143699351 |
| Molecular Formula | C21H30N4O7S3 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | [3-[[6-(1-aminosulfanylethenylsulfanyl)-2-(3-methoxypropyl)-5-methyl-1,1-dioxo-3,4-dihydrothiazin-4-yl]-ethylcarbamoyl]phenyl]methyl nitrate |
| SMILES | C=C(SN)SC1=C(C)C(N(CC)C(=O)c2cccc(CO[N+](=O)[O-])c2)CN(CCCOC)S1(=O)=O |
| InChI | InChI=1S/C21H30N4O7S3/c1-5-24(20(26)18-9-6-8-17(12-18)14-32-25(27)28)19-13-23(10-7-11-31-4)35(29,30)21(15(19)2)33-16(3)34-22/h6,8-9,12,19H,3,5,7,10-11,13-14,22H2,1-2,4H3 |
| InChIKey | CCHQNKBOKDCKFL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 145.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|