C17H20N2O5 — CID 98441288
(E)-3-(3,4-dimethoxyphenyl)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethylprop-2-enamide (PubChem CID 98441288) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 98441288 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethylprop-2-enamide |
| SMILES | CCN(C(=O)/C=C/c1ccc(OC)c(OC)c1)[C@@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C17H20N2O5/c1-4-19(12-10-15(20)18-17(12)22)16(21)8-6-11-5-7-13(23-2)14(9-11)24-3/h5-9,12H,4,10H2,1-3H3,(H,18,20,22)/b8-6+/t12-/m1/s1 |
| InChIKey | UJCBAUCCEDFWHP-WAFBPQNNSA-N |
| XLogP | 0.98 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|