C18H22N2O6 — CID 52514087
(E)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 52514087) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is (E)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 52514087 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (E)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | CCN(C(=O)/C=C/c1cc(OC)c(OC)c(OC)c1)[C@@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C18H22N2O6/c1-5-20(12-10-15(21)19-18(12)23)16(22)7-6-11-8-13(24-2)17(26-4)14(9-11)25-3/h6-9,12H,5,10H2,1-4H3,(H,19,21,23)/b7-6+/t12-/m1/s1 |
| InChIKey | KOCYWWSUKYDLNF-NNNHXZLVSA-N |
| XLogP | 0.99 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|