C18H20N2O5 — CID 98516549
(Z)-N-cyclopropyl-3-(3,5-dimethoxyphenyl)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]prop-2-enamide (PubChem CID 98516549) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (Z)-N-cyclopropyl-3-(3,5-dimethoxyphenyl)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]prop-2-enamide.
| Compound Name | (Z)-N-cyclopropyl-3-(3,5-dimethoxyphenyl)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 98516549 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (Z)-N-cyclopropyl-3-(3,5-dimethoxyphenyl)-N-[(3R)-2,5-dioxopyrrolidin-3-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C\C(=O)N(C2CC2)[C@@H]2CC(=O)NC2=O)cc(OC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-24-13-7-11(8-14(9-13)25-2)3-6-17(22)20(12-4-5-12)15-10-16(21)19-18(15)23/h3,6-9,12,15H,4-5,10H2,1-2H3,(H,19,21,23)/b6-3-/t15-/m1/s1 |
| InChIKey | LFFTZCKCIDSTIB-OMVNSRBRSA-N |
| XLogP | 1.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|