C18H23NO6 — CID 129009136
2-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]-(oxan-4-yl)amino]acetic acid (PubChem CID 129009136) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 2-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]-(oxan-4-yl)amino]acetic acid.
| Compound Name | 2-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]-(oxan-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 129009136 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]-(oxan-4-yl)amino]acetic acid |
| SMILES | COc1cc(/C=C/C(=O)N(CC(=O)O)C2CCOCC2)cc(OC)c1 |
| InChI | InChI=1S/C18H23NO6/c1-23-15-9-13(10-16(11-15)24-2)3-4-17(20)19(12-18(21)22)14-5-7-25-8-6-14/h3-4,9-11,14H,5-8,12H2,1-2H3,(H,21,22)/b4-3+ |
| InChIKey | KUVOHBGXMCZKAD-ONEGZZNKSA-N |
| XLogP | 1.81 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|