C18H22N2O5 — CID 126778630
2-[3-[4-(methylcarbamoyl)phenyl]prop-2-enoyl-(oxan-4-yl)amino]acetic acid (PubChem CID 126778630) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[3-[4-(methylcarbamoyl)phenyl]prop-2-enoyl-(oxan-4-yl)amino]acetic acid.
| Compound Name | 2-[3-[4-(methylcarbamoyl)phenyl]prop-2-enoyl-(oxan-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 126778630 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[3-[4-(methylcarbamoyl)phenyl]prop-2-enoyl-(oxan-4-yl)amino]acetic acid |
| SMILES | CNC(=O)c1ccc(C=CC(=O)N(CC(=O)O)C2CCOCC2)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-19-18(24)14-5-2-13(3-6-14)4-7-16(21)20(12-17(22)23)15-8-10-25-11-9-15/h2-7,15H,8-12H2,1H3,(H,19,24)(H,22,23) |
| InChIKey | NVCCFBMLIPEJTC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|