C18H23NO4 — CID 132967853
2-[[(Z)-3-(2,4-dimethylphenyl)prop-2-enoyl]-(oxan-4-yl)amino]acetic acid (PubChem CID 132967853) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[[(Z)-3-(2,4-dimethylphenyl)prop-2-enoyl]-(oxan-4-yl)amino]acetic acid.
| Compound Name | 2-[[(Z)-3-(2,4-dimethylphenyl)prop-2-enoyl]-(oxan-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 132967853 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-[[(Z)-3-(2,4-dimethylphenyl)prop-2-enoyl]-(oxan-4-yl)amino]acetic acid |
| SMILES | Cc1ccc(/C=C\C(=O)N(CC(=O)O)C2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C18H23NO4/c1-13-3-4-15(14(2)11-13)5-6-17(20)19(12-18(21)22)16-7-9-23-10-8-16/h3-6,11,16H,7-10,12H2,1-2H3,(H,21,22)/b6-5- |
| InChIKey | KOVMWNOZMOUEDR-WAYWQWQTSA-N |
| XLogP | 2.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|