C13H17NO5 — CID 154740702
2-[(2-methylfuran-3-carbonyl)-(oxan-4-yl)amino]acetic acid (PubChem CID 154740702) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[(2-methylfuran-3-carbonyl)-(oxan-4-yl)amino]acetic acid.
| Compound Name | 2-[(2-methylfuran-3-carbonyl)-(oxan-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 154740702 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[(2-methylfuran-3-carbonyl)-(oxan-4-yl)amino]acetic acid |
| SMILES | Cc1occc1C(=O)N(CC(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C13H17NO5/c1-9-11(4-7-19-9)13(17)14(8-12(15)16)10-2-5-18-6-3-10/h4,7,10H,2-3,5-6,8H2,1H3,(H,15,16) |
| InChIKey | RPLSMWIEJLXIDJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |