C19H23NO2 — CID 52574458
N-cyclopentyl-2-methyl-N-(2-phenylethyl)furan-3-carboxamide (PubChem CID 52574458) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-cyclopentyl-2-methyl-N-(2-phenylethyl)furan-3-carboxamide.
| Compound Name | N-cyclopentyl-2-methyl-N-(2-phenylethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 52574458 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-cyclopentyl-2-methyl-N-(2-phenylethyl)furan-3-carboxamide |
| SMILES | Cc1occc1C(=O)N(CCc1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H23NO2/c1-15-18(12-14-22-15)19(21)20(17-9-5-6-10-17)13-11-16-7-3-2-4-8-16/h2-4,7-8,12,14,17H,5-6,9-11,13H2,1H3 |
| InChIKey | SCECNIXNXZZNSK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |