C19H25NO5 — CID 126789602
3-[3-(2-methoxy-5-methylphenyl)prop-2-enoyl-(oxan-4-yl)amino]propanoic acid (PubChem CID 126789602) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-[3-(2-methoxy-5-methylphenyl)prop-2-enoyl-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[3-(2-methoxy-5-methylphenyl)prop-2-enoyl-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 126789602 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-[3-(2-methoxy-5-methylphenyl)prop-2-enoyl-(oxan-4-yl)amino]propanoic acid |
| SMILES | COc1ccc(C)cc1C=CC(=O)N(CCC(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C19H25NO5/c1-14-3-5-17(24-2)15(13-14)4-6-18(21)20(10-7-19(22)23)16-8-11-25-12-9-16/h3-6,13,16H,7-12H2,1-2H3,(H,22,23) |
| InChIKey | SUQAZXISAYJDNA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|