C17H23NO6 — CID 119211212
2-[[2-(2-methoxy-4-methylphenoxy)acetyl]-(oxan-4-yl)amino]acetic acid (PubChem CID 119211212) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[[2-(2-methoxy-4-methylphenoxy)acetyl]-(oxan-4-yl)amino]acetic acid.
| Compound Name | 2-[[2-(2-methoxy-4-methylphenoxy)acetyl]-(oxan-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 119211212 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[[2-(2-methoxy-4-methylphenoxy)acetyl]-(oxan-4-yl)amino]acetic acid |
| SMILES | COc1cc(C)ccc1OCC(=O)N(CC(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C17H23NO6/c1-12-3-4-14(15(9-12)22-2)24-11-16(19)18(10-17(20)21)13-5-7-23-8-6-13/h3-4,9,13H,5-8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | XMYPHKRPCFTREH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |