C19H27NO3S — CID 42884758
(E)-3-(2,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 42884758) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 42884758 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(CC(C)C)C2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C19H27NO3S/c1-14(2)12-20(18-9-10-24(22,23)13-18)19(21)8-7-17-6-5-15(3)11-16(17)4/h5-8,11,14,18H,9-10,12-13H2,1-4H3/b8-7+ |
| InChIKey | YJNJIOOUPKHZOP-BQYQJAHWSA-N |
| XLogP | 2.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|