C19H27ClN2O3S — CID 78837656
(E)-3-(3-chloro-4-methylphenyl)-N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 78837656) has the molecular formula C19H27ClN2O3S and a molecular weight of 398.96 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-methylphenyl)-N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-methylphenyl)-N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 78837656 |
| Molecular Formula | C19H27ClN2O3S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (E)-3-(3-chloro-4-methylphenyl)-N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(CCCN(C)C)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C19H27ClN2O3S/c1-15-5-6-16(13-18(15)20)7-8-19(23)22(11-4-10-21(2)3)17-9-12-26(24,25)14-17/h5-8,13,17H,4,9-12,14H2,1-3H3/b8-7+ |
| InChIKey | RCGSPVFUQLKDRZ-BQYQJAHWSA-N |
| XLogP | 2.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|