C18H25N3O5S — CID 78837588
(E)-N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 78837588) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is (E)-N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78837588 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (E)-N-[3-(dimethylamino)propyl]-N-(1,1-dioxothiolan-3-yl)-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | CN(C)CCCN(C(=O)/C=C/c1ccccc1[N+](=O)[O-])C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H25N3O5S/c1-19(2)11-5-12-20(16-10-13-27(25,26)14-16)18(22)9-8-15-6-3-4-7-17(15)21(23)24/h3-4,6-9,16H,5,10-14H2,1-2H3/b9-8+ |
| InChIKey | YMWARBLYWWMZCU-CMDGGOBGSA-N |
| XLogP | 1.58 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|