C16H17F3N2O4 — CID 90554786
(E)-3-(4-nitrophenyl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 90554786) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-(4-nitrophenyl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 90554786 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C16H17F3N2O4/c17-16(18,19)11-20(13-7-9-25-10-8-13)15(22)6-3-12-1-4-14(5-2-12)21(23)24/h1-6,13H,7-11H2/b6-3+ |
| InChIKey | WLTYEWVSTWWWPK-ZZXKWVIFSA-N |
| XLogP | 3.18 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|