C23H23N3O4 — CID 34178930
N-cyclopropyl-4-[[cyclopropyl-[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]benzamide (PubChem CID 34178930) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-cyclopropyl-4-[[cyclopropyl-[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[cyclopropyl-[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 34178930 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-cyclopropyl-4-[[cyclopropyl-[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(CN(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)C2CC2)cc1 |
| InChI | InChI=1S/C23H23N3O4/c27-22(14-5-16-3-10-21(11-4-16)26(29)30)25(20-12-13-20)15-17-1-6-18(7-2-17)23(28)24-19-8-9-19/h1-7,10-11,14,19-20H,8-9,12-13,15H2,(H,24,28)/b14-5+ |
| InChIKey | GDFAYIKPVBFDMK-LHHJGKSTSA-N |
| XLogP | 3.69 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|