C22H23N3O4 — CID 33342098
N-cyclopropyl-4-[[cyclopropyl-[2-(2-nitrophenyl)acetyl]amino]methyl]benzamide (PubChem CID 33342098) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-cyclopropyl-4-[[cyclopropyl-[2-(2-nitrophenyl)acetyl]amino]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[cyclopropyl-[2-(2-nitrophenyl)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 33342098 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-cyclopropyl-4-[[cyclopropyl-[2-(2-nitrophenyl)acetyl]amino]methyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(CN(C(=O)Cc2ccccc2[N+](=O)[O-])C2CC2)cc1 |
| InChI | InChI=1S/C22H23N3O4/c26-21(13-17-3-1-2-4-20(17)25(28)29)24(19-11-12-19)14-15-5-7-16(8-6-15)22(27)23-18-9-10-18/h1-8,18-19H,9-14H2,(H,23,27) |
| InChIKey | NWHNCKDWUDUABZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|