C22H23FN2O2 — CID 34178957
N-cyclopropyl-4-[[cyclopropyl-[2-(4-fluorophenyl)acetyl]amino]methyl]benzamide (PubChem CID 34178957) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is N-cyclopropyl-4-[[cyclopropyl-[2-(4-fluorophenyl)acetyl]amino]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[cyclopropyl-[2-(4-fluorophenyl)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 34178957 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-cyclopropyl-4-[[cyclopropyl-[2-(4-fluorophenyl)acetyl]amino]methyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(CN(C(=O)Cc2ccc(F)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C22H23FN2O2/c23-18-7-3-15(4-8-18)13-21(26)25(20-11-12-20)14-16-1-5-17(6-2-16)22(27)24-19-9-10-19/h1-8,19-20H,9-14H2,(H,24,27) |
| InChIKey | VVTZNQZJNATOEC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |