C22H23FN2O2S — CID 33339728
N-cyclopropyl-4-[[cyclopropyl-[2-(4-fluorophenyl)sulfanylacetyl]amino]methyl]benzamide (PubChem CID 33339728) has the molecular formula C22H23FN2O2S and a molecular weight of 398.50 g/mol. Its IUPAC name is N-cyclopropyl-4-[[cyclopropyl-[2-(4-fluorophenyl)sulfanylacetyl]amino]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[cyclopropyl-[2-(4-fluorophenyl)sulfanylacetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 33339728 |
| Molecular Formula | C22H23FN2O2S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-cyclopropyl-4-[[cyclopropyl-[2-(4-fluorophenyl)sulfanylacetyl]amino]methyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(CN(C(=O)CSc2ccc(F)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C22H23FN2O2S/c23-17-5-11-20(12-6-17)28-14-21(26)25(19-9-10-19)13-15-1-3-16(4-2-15)22(27)24-18-7-8-18/h1-6,11-12,18-19H,7-10,13-14H2,(H,24,27) |
| InChIKey | YLCGNDFWJTUZDL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |