C26H27N3O4 — CID 34179073
4-[[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]-cyclopropylamino]methyl]-N-cyclopropylbenzamide (PubChem CID 34179073) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]-cyclopropylamino]methyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]-cyclopropylamino]methyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 34179073 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-[[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]-cyclopropylamino]methyl]-N-cyclopropylbenzamide |
| SMILES | COc1cc(/C=C/C(=O)N(Cc2ccc(C(=O)NC3CC3)cc2)C2CC2)ccc1OCC#N |
| InChI | InChI=1S/C26H27N3O4/c1-32-24-16-18(4-12-23(24)33-15-14-27)5-13-25(30)29(22-10-11-22)17-19-2-6-20(7-3-19)26(31)28-21-8-9-21/h2-7,12-13,16,21-22H,8-11,15,17H2,1H3,(H,28,31)/b13-5+ |
| InChIKey | MWWGHWKGQJXMAB-WLRTZDKTSA-N |
| XLogP | 3.69 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|