C21H21BrClNO6 — CID 19206078
[2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate (PubChem CID 19206078) has the molecular formula C21H21BrClNO6 and a molecular weight of 498.76 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate.
| Compound Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 19206078 |
| Molecular Formula | C21H21BrClNO6 |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate |
| SMILES | COc1cc(/C=C/[N+](=O)[O-])ccc1OC(=O)CCCOc1cc(C)c(Cl)c(C)c1Br |
| InChI | InChI=1S/C21H21BrClNO6/c1-13-11-18(20(22)14(2)21(13)23)29-10-4-5-19(25)30-16-7-6-15(8-9-24(26)27)12-17(16)28-3/h6-9,11-12H,4-5,10H2,1-3H3/b9-8+ |
| InChIKey | IECSBMWHFFWVGI-CMDGGOBGSA-N |
| XLogP | 5.74 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|