C20H22BrClO3 — CID 19206055
(2,6-dimethylphenyl) 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate (PubChem CID 19206055) has the molecular formula C20H22BrClO3 and a molecular weight of 425.75 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate.
| Compound Name | (2,6-dimethylphenyl) 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 19206055 |
| Molecular Formula | C20H22BrClO3 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | (2,6-dimethylphenyl) 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)Oc2c(C)cccc2C)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C20H22BrClO3/c1-12-7-5-8-13(2)20(12)25-17(23)9-6-10-24-16-11-14(3)19(22)15(4)18(16)21/h5,7-8,11H,6,9-10H2,1-4H3 |
| InChIKey | FBHXLZVROLXVHW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|