C23H22Br2ClNO5 — CID 19206107
3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate (PubChem CID 19206107) has the molecular formula C23H22Br2ClNO5 and a molecular weight of 587.69 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 19206107 |
| Molecular Formula | C23H22Br2ClNO5 |
| Molecular Weight | 587.69 g/mol |
| Exact Mass | 584.96 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)OCCCN2C(=O)c3ccc(Br)cc3C2=O)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C23H22Br2ClNO5/c1-13-11-18(20(25)14(2)21(13)26)31-9-3-5-19(28)32-10-4-8-27-22(29)16-7-6-15(24)12-17(16)23(27)30/h6-7,11-12H,3-5,8-10H2,1-2H3 |
| InChIKey | DGLQCUJWKFBSDZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|