C18H12BrCl2NO4 — CID 19181966
3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 3,4-dichlorobenzoate (PubChem CID 19181966) has the molecular formula C18H12BrCl2NO4 and a molecular weight of 457.11 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 3,4-dichlorobenzoate.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19181966 |
| Molecular Formula | C18H12BrCl2NO4 |
| Molecular Weight | 457.11 g/mol |
| Exact Mass | 454.93 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 3,4-dichlorobenzoate |
| SMILES | O=C(OCCCN1C(=O)c2ccc(Br)cc2C1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H12BrCl2NO4/c19-11-3-4-12-13(9-11)17(24)22(16(12)23)6-1-7-26-18(25)10-2-5-14(20)15(21)8-10/h2-5,8-9H,1,6-7H2 |
| InChIKey | DSJYMFQKGNKVKK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.11 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|