C24H26BrNO4 — CID 19221375
3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 3-(4-tert-butylphenyl)propanoate (PubChem CID 19221375) has the molecular formula C24H26BrNO4 and a molecular weight of 472.38 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 3-(4-tert-butylphenyl)propanoate.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 3-(4-tert-butylphenyl)propanoate |
|---|---|
| PubChem CID | 19221375 |
| Molecular Formula | C24H26BrNO4 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 3-(4-tert-butylphenyl)propanoate |
| SMILES | CC(C)(C)c1ccc(CCC(=O)OCCCN2C(=O)c3ccc(Br)cc3C2=O)cc1 |
| InChI | InChI=1S/C24H26BrNO4/c1-24(2,3)17-8-5-16(6-9-17)7-12-21(27)30-14-4-13-26-22(28)19-11-10-18(25)15-20(19)23(26)29/h5-6,8-11,15H,4,7,12-14H2,1-3H3 |
| InChIKey | WRPNXFNJQZWSFC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|