C20H17BrN2O7 — CID 2072570
3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 2-(2-methyl-4-nitrophenoxy)acetate (PubChem CID 2072570) has the molecular formula C20H17BrN2O7 and a molecular weight of 477.27 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 2-(2-methyl-4-nitrophenoxy)acetate.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 2-(2-methyl-4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 2072570 |
| Molecular Formula | C20H17BrN2O7 |
| Molecular Weight | 477.27 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 2-(2-methyl-4-nitrophenoxy)acetate |
| SMILES | Cc1cc([N+](=O)[O-])ccc1OCC(=O)OCCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C20H17BrN2O7/c1-12-9-14(23(27)28)4-6-17(12)30-11-18(24)29-8-2-7-22-19(25)15-5-3-13(21)10-16(15)20(22)26/h3-6,9-10H,2,7-8,11H2,1H3 |
| InChIKey | IZENUJWHGADLLF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|