C23H23Br2NO5 — CID 19180722
3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 2-(4-bromo-2-tert-butylphenoxy)acetate (PubChem CID 19180722) has the molecular formula C23H23Br2NO5 and a molecular weight of 553.25 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 2-(4-bromo-2-tert-butylphenoxy)acetate.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 2-(4-bromo-2-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 19180722 |
| Molecular Formula | C23H23Br2NO5 |
| Molecular Weight | 553.25 g/mol |
| Exact Mass | 550.99 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)propyl 2-(4-bromo-2-tert-butylphenoxy)acetate |
| SMILES | CC(C)(C)c1cc(Br)ccc1OCC(=O)OCCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C23H23Br2NO5/c1-23(2,3)18-12-15(25)6-8-19(18)31-13-20(27)30-10-4-9-26-21(28)16-7-5-14(24)11-17(16)22(26)29/h5-8,11-12H,4,9-10,13H2,1-3H3 |
| InChIKey | ZSTYCTXLQVWWDN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|