C25H25BrClNO6 — CID 19206108
3-[(2-oxochromene-3-carbonyl)amino]propyl 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate (PubChem CID 19206108) has the molecular formula C25H25BrClNO6 and a molecular weight of 550.83 g/mol. Its IUPAC name is 3-[(2-oxochromene-3-carbonyl)amino]propyl 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate.
| Compound Name | 3-[(2-oxochromene-3-carbonyl)amino]propyl 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 19206108 |
| Molecular Formula | C25H25BrClNO6 |
| Molecular Weight | 550.83 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 3-[(2-oxochromene-3-carbonyl)amino]propyl 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)OCCCNC(=O)c2cc3ccccc3oc2=O)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C25H25BrClNO6/c1-15-13-20(22(26)16(2)23(15)27)32-11-5-9-21(29)33-12-6-10-28-24(30)18-14-17-7-3-4-8-19(17)34-25(18)31/h3-4,7-8,13-14H,5-6,9-12H2,1-2H3,(H,28,30) |
| InChIKey | VVOYZZYBIXUANU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.83 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|