C20H15Cl2NO5 — CID 19182213
3-[(2-oxochromene-3-carbonyl)amino]propyl 3,4-dichlorobenzoate (PubChem CID 19182213) has the molecular formula C20H15Cl2NO5 and a molecular weight of 420.25 g/mol. Its IUPAC name is 3-[(2-oxochromene-3-carbonyl)amino]propyl 3,4-dichlorobenzoate.
| Compound Name | 3-[(2-oxochromene-3-carbonyl)amino]propyl 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19182213 |
| Molecular Formula | C20H15Cl2NO5 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 3-[(2-oxochromene-3-carbonyl)amino]propyl 3,4-dichlorobenzoate |
| SMILES | O=C(OCCCNC(=O)c1cc2ccccc2oc1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2NO5/c21-15-7-6-13(11-16(15)22)19(25)27-9-3-8-23-18(24)14-10-12-4-1-2-5-17(12)28-20(14)26/h1-2,4-7,10-11H,3,8-9H2,(H,23,24) |
| InChIKey | ZOUANVQFSDDLMP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|