C21H17Br2NO6 — CID 19179701
3-[(2-oxochromene-3-carbonyl)amino]propyl 2-(2,4-dibromophenoxy)acetate (PubChem CID 19179701) has the molecular formula C21H17Br2NO6 and a molecular weight of 539.18 g/mol. Its IUPAC name is 3-[(2-oxochromene-3-carbonyl)amino]propyl 2-(2,4-dibromophenoxy)acetate.
| Compound Name | 3-[(2-oxochromene-3-carbonyl)amino]propyl 2-(2,4-dibromophenoxy)acetate |
|---|---|
| PubChem CID | 19179701 |
| Molecular Formula | C21H17Br2NO6 |
| Molecular Weight | 539.18 g/mol |
| Exact Mass | 536.94 |
| IUPAC Name | 3-[(2-oxochromene-3-carbonyl)amino]propyl 2-(2,4-dibromophenoxy)acetate |
| SMILES | O=C(COc1ccc(Br)cc1Br)OCCCNC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C21H17Br2NO6/c22-14-6-7-18(16(23)11-14)29-12-19(25)28-9-3-8-24-20(26)15-10-13-4-1-2-5-17(13)30-21(15)27/h1-2,4-7,10-11H,3,8-9,12H2,(H,24,26) |
| InChIKey | QNPHQPUUTYIIGX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.18 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|