C20H21BrClNO3 — CID 19205996
N-(4-acetylphenyl)-4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanamide (PubChem CID 19205996) has the molecular formula C20H21BrClNO3 and a molecular weight of 438.75 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanamide.
| Compound Name | N-(4-acetylphenyl)-4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 19205996 |
| Molecular Formula | C20H21BrClNO3 |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-(4-acetylphenyl)-4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanamide |
| SMILES | CC(=O)c1ccc(NC(=O)CCCOc2cc(C)c(Cl)c(C)c2Br)cc1 |
| InChI | InChI=1S/C20H21BrClNO3/c1-12-11-17(19(21)13(2)20(12)22)26-10-4-5-18(25)23-16-8-6-15(7-9-16)14(3)24/h6-9,11H,4-5,10H2,1-3H3,(H,23,25) |
| InChIKey | CVYTUOWMELLRJU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|