C19H17BrCl2F3NO2 — CID 19205971
4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide (PubChem CID 19205971) has the molecular formula C19H17BrCl2F3NO2 and a molecular weight of 499.15 g/mol. Its IUPAC name is 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 19205971 |
| Molecular Formula | C19H17BrCl2F3NO2 |
| Molecular Weight | 499.15 g/mol |
| Exact Mass | 496.98 |
| IUPAC Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-chloro-3-(trifluoromethyl)phenyl]butanamide |
| SMILES | Cc1cc(OCCCC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C19H17BrCl2F3NO2/c1-10-8-15(17(20)11(2)18(10)22)28-7-3-4-16(27)26-12-5-6-14(21)13(9-12)19(23,24)25/h5-6,8-9H,3-4,7H2,1-2H3,(H,26,27) |
| InChIKey | JTVGOCBCRAJEOX-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.15 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|