C24H26BrClN4O4S — CID 19205989
4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]butanamide (PubChem CID 19205989) has the molecular formula C24H26BrClN4O4S and a molecular weight of 581.92 g/mol. Its IUPAC name is 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]butanamide.
| Compound Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 19205989 |
| Molecular Formula | C24H26BrClN4O4S |
| Molecular Weight | 581.92 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]butanamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)CCCOc3cc(C)c(Cl)c(C)c3Br)cc2)n1 |
| InChI | InChI=1S/C24H26BrClN4O4S/c1-14-12-20(22(25)17(4)23(14)26)34-11-5-6-21(31)29-18-7-9-19(10-8-18)35(32,33)30-24-27-15(2)13-16(3)28-24/h7-10,12-13H,5-6,11H2,1-4H3,(H,29,31)(H,27,28,30) |
| InChIKey | VSATVSCBAQENTE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.92 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|