C21H25BrClNO2 — CID 19205871
4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(2-propan-2-ylphenyl)butanamide (PubChem CID 19205871) has the molecular formula C21H25BrClNO2 and a molecular weight of 438.79 g/mol. Its IUPAC name is 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(2-propan-2-ylphenyl)butanamide.
| Compound Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(2-propan-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 19205871 |
| Molecular Formula | C21H25BrClNO2 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(2-propan-2-ylphenyl)butanamide |
| SMILES | Cc1cc(OCCCC(=O)Nc2ccccc2C(C)C)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C21H25BrClNO2/c1-13(2)16-8-5-6-9-17(16)24-19(25)10-7-11-26-18-12-14(3)21(23)15(4)20(18)22/h5-6,8-9,12-13H,7,10-11H2,1-4H3,(H,24,25) |
| InChIKey | LRDDQXWNDGWZSN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|