C22H24BrCl2NO5 — CID 19229058
ethyl 4-[4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoylamino]-5-chloro-2-methoxybenzoate (PubChem CID 19229058) has the molecular formula C22H24BrCl2NO5 and a molecular weight of 533.25 g/mol. Its IUPAC name is ethyl 4-[4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoylamino]-5-chloro-2-methoxybenzoate.
| Compound Name | ethyl 4-[4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoylamino]-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 19229058 |
| Molecular Formula | C22H24BrCl2NO5 |
| Molecular Weight | 533.25 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | ethyl 4-[4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanoylamino]-5-chloro-2-methoxybenzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(NC(=O)CCCOc2cc(C)c(Cl)c(C)c2Br)cc1OC |
| InChI | InChI=1S/C22H24BrCl2NO5/c1-5-30-22(28)14-10-15(24)16(11-17(14)29-4)26-19(27)7-6-8-31-18-9-12(2)21(25)13(3)20(18)23/h9-11H,5-8H2,1-4H3,(H,26,27) |
| InChIKey | SVQLTNQALBBIAB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.25 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|