C20H21BrClNO5 — CID 19228737
ethyl 4-[[2-(4-bromo-2-ethylphenoxy)acetyl]amino]-5-chloro-2-methoxybenzoate (PubChem CID 19228737) has the molecular formula C20H21BrClNO5 and a molecular weight of 470.75 g/mol. Its IUPAC name is ethyl 4-[[2-(4-bromo-2-ethylphenoxy)acetyl]amino]-5-chloro-2-methoxybenzoate.
| Compound Name | ethyl 4-[[2-(4-bromo-2-ethylphenoxy)acetyl]amino]-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 19228737 |
| Molecular Formula | C20H21BrClNO5 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | ethyl 4-[[2-(4-bromo-2-ethylphenoxy)acetyl]amino]-5-chloro-2-methoxybenzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(NC(=O)COc2ccc(Br)cc2CC)cc1OC |
| InChI | InChI=1S/C20H21BrClNO5/c1-4-12-8-13(21)6-7-17(12)28-11-19(24)23-16-10-18(26-3)14(9-15(16)22)20(25)27-5-2/h6-10H,4-5,11H2,1-3H3,(H,23,24) |
| InChIKey | QFJQUBKJQLNNSQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |