C23H28ClNO4 — CID 19229359
ethyl 4-[3-(4-tert-butylphenyl)propanoylamino]-5-chloro-2-methoxybenzoate (PubChem CID 19229359) has the molecular formula C23H28ClNO4 and a molecular weight of 417.93 g/mol. Its IUPAC name is ethyl 4-[3-(4-tert-butylphenyl)propanoylamino]-5-chloro-2-methoxybenzoate.
| Compound Name | ethyl 4-[3-(4-tert-butylphenyl)propanoylamino]-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 19229359 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | ethyl 4-[3-(4-tert-butylphenyl)propanoylamino]-5-chloro-2-methoxybenzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(NC(=O)CCc2ccc(C(C)(C)C)cc2)cc1OC |
| InChI | InChI=1S/C23H28ClNO4/c1-6-29-22(27)17-13-18(24)19(14-20(17)28-5)25-21(26)12-9-15-7-10-16(11-8-15)23(2,3)4/h7-8,10-11,13-14H,6,9,12H2,1-5H3,(H,25,26) |
| InChIKey | RPLIGMXLWSBRKO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |