C19H20BrClN2O5 — CID 19206004
4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(2-methoxy-5-nitrophenyl)butanamide (PubChem CID 19206004) has the molecular formula C19H20BrClN2O5 and a molecular weight of 471.74 g/mol. Its IUPAC name is 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(2-methoxy-5-nitrophenyl)butanamide.
| Compound Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(2-methoxy-5-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 19206004 |
| Molecular Formula | C19H20BrClN2O5 |
| Molecular Weight | 471.74 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-(2-methoxy-5-nitrophenyl)butanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CCCOc1cc(C)c(Cl)c(C)c1Br |
| InChI | InChI=1S/C19H20BrClN2O5/c1-11-9-16(18(20)12(2)19(11)21)28-8-4-5-17(24)22-14-10-13(23(25)26)6-7-15(14)27-3/h6-7,9-10H,4-5,8H2,1-3H3,(H,22,24) |
| InChIKey | DQGNEQMIXGMWDK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.74 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|