C25H25BrClNO2 — CID 19205916
N-benzhydryl-4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanamide (PubChem CID 19205916) has the molecular formula C25H25BrClNO2 and a molecular weight of 486.84 g/mol. Its IUPAC name is N-benzhydryl-4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanamide.
| Compound Name | N-benzhydryl-4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 19205916 |
| Molecular Formula | C25H25BrClNO2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | N-benzhydryl-4-(2-bromo-4-chloro-3,5-dimethylphenoxy)butanamide |
| SMILES | Cc1cc(OCCCC(=O)NC(c2ccccc2)c2ccccc2)c(Br)c(C)c1Cl |
| InChI | InChI=1S/C25H25BrClNO2/c1-17-16-21(23(26)18(2)24(17)27)30-15-9-14-22(29)28-25(19-10-5-3-6-11-19)20-12-7-4-8-13-20/h3-8,10-13,16,25H,9,14-15H2,1-2H3,(H,28,29) |
| InChIKey | XMHIAQLBVNYUPS-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|