C20H21NO6 — CID 19226161
[2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-(4-ethoxyphenyl)propanoate (PubChem CID 19226161) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-(4-ethoxyphenyl)propanoate.
| Compound Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-(4-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 19226161 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-(4-ethoxyphenyl)propanoate |
| SMILES | CCOc1ccc(CCC(=O)Oc2ccc(/C=C/[N+](=O)[O-])cc2OC)cc1 |
| InChI | InChI=1S/C20H21NO6/c1-3-26-17-8-4-15(5-9-17)7-11-20(22)27-18-10-6-16(12-13-21(23)24)14-19(18)25-2/h4-6,8-10,12-14H,3,7,11H2,1-2H3/b13-12+ |
| InChIKey | KMIHKMSKRWWFNI-OUKQBFOZSA-N |
| XLogP | 3.88 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|