About [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate
[2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate (PubChem CID 1406543) has the molecular formula C19H19NO5
and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate.
Molecular Properties
| Compound Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate |
| PubChem CID | 1406543 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate |
| SMILES | COc1cc(/C=C/[N+](=O)[O-])ccc1OC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-13(2)15-5-7-16(8-6-15)19(21)25-17-9-4-14(10-11-20(22)23)12-18(17)24-3/h4-13H,1-3H3/b11-10+ |
| InChIKey | RKIYVRJKEOCDMD-ZHACJKMWSA-N |
| XLogP | 4.29 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate?
The IUPAC name of [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate (CID 1406543) is [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate.
What is the SMILES notation for [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate?
The canonical SMILES for [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate is COc1cc(/C=C/[N+](=O)[O-])ccc1OC(=O)c1ccc(C(C)C)cc1.
What is the InChIKey of [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate?
The InChIKey is RKIYVRJKEOCDMD-ZHACJKMWSA-N. The full InChI is InChI=1S/C19H19NO5/c1-13(2)15-5-7-16(8-6-15)19(21)25-17-9-4-14(10-11-20(22)23)12-18(17)24-3/h4-13H,1-3H3/b11-10+.
What are the key properties of [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate?
[2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate has a molecular weight of 341.36 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 4-propan-2-ylbenzoate is sourced from PubChem (CID 1406543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).