About [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate
[2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate (PubChem CID 19170376) has the molecular formula C17H15NO5
and a molecular weight of 313.31 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate.
Molecular Properties
| Compound Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate |
| PubChem CID | 19170376 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate |
| SMILES | COc1cc(/C=C/[N+](=O)[O-])ccc1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C17H15NO5/c1-12-4-3-5-14(10-12)17(19)23-15-7-6-13(8-9-18(20)21)11-16(15)22-2/h3-11H,1-2H3/b9-8+ |
| InChIKey | RUZSZZZCGJRMNP-CMDGGOBGSA-N |
| XLogP | 3.47 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate?
The IUPAC name of [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate (CID 19170376) is [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate.
What is the SMILES notation for [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate?
The canonical SMILES for [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate is COc1cc(/C=C/[N+](=O)[O-])ccc1OC(=O)c1cccc(C)c1.
What is the InChIKey of [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate?
The InChIKey is RUZSZZZCGJRMNP-CMDGGOBGSA-N. The full InChI is InChI=1S/C17H15NO5/c1-12-4-3-5-14(10-12)17(19)23-15-7-6-13(8-9-18(20)21)11-16(15)22-2/h3-11H,1-2H3/b9-8+.
What are the key properties of [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate?
[2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate has a molecular weight of 313.31 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-4-[(E)-2-nitroethenyl]phenyl] 3-methylbenzoate is sourced from PubChem (CID 19170376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).