C32H36Cl2N2O4 — CID 141228826
[2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 141228826) has the molecular formula C32H36Cl2N2O4 and a molecular weight of 583.56 g/mol. Its IUPAC name is [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 141228826 |
| Molecular Formula | C32H36Cl2N2O4 |
| Molecular Weight | 583.56 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | [2-methoxy-4-[(8-methylnon-6-enoylamino)methyl]phenyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1OC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C32H36Cl2N2O4/c1-22(2)11-6-4-5-7-16-30(37)35-21-23-17-18-28(29(19-23)39-3)40-31(38)20-24-12-8-9-15-27(24)36-32-25(33)13-10-14-26(32)34/h6,8-15,17-19,22,36H,4-5,7,16,20-21H2,1-3H3,(H,35,37) |
| InChIKey | NFWCZASYEZTJKK-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.56 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|