C22H22N2O9 — CID 143380955
[2-methoxy-4-[(E)-3-[[4-(nitrooxymethyl)phenyl]methoxy]-3-oxoprop-1-enyl]phenyl] 2-formamidopropanoate (PubChem CID 143380955) has the molecular formula C22H22N2O9 and a molecular weight of 458.42 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-[[4-(nitrooxymethyl)phenyl]methoxy]-3-oxoprop-1-enyl]phenyl] 2-formamidopropanoate.
| Compound Name | [2-methoxy-4-[(E)-3-[[4-(nitrooxymethyl)phenyl]methoxy]-3-oxoprop-1-enyl]phenyl] 2-formamidopropanoate |
|---|---|
| PubChem CID | 143380955 |
| Molecular Formula | C22H22N2O9 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [2-methoxy-4-[(E)-3-[[4-(nitrooxymethyl)phenyl]methoxy]-3-oxoprop-1-enyl]phenyl] 2-formamidopropanoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccc(CO[N+](=O)[O-])cc2)ccc1OC(=O)C(C)NC=O |
| InChI | InChI=1S/C22H22N2O9/c1-15(23-14-25)22(27)33-19-9-7-16(11-20(19)30-2)8-10-21(26)31-12-17-3-5-18(6-4-17)13-32-24(28)29/h3-11,14-15H,12-13H2,1-2H3,(H,23,25)/b10-8+ |
| InChIKey | LQULAEBHHOMTFM-CSKARUKUSA-N |
| XLogP | 2.20 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|