C19H28O5 — CID 71109558
2-butyl-8-[4-hydroxy-3-(hydroxymethyl)phenyl]-6-oxooctanoic acid (PubChem CID 71109558) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-butyl-8-[4-hydroxy-3-(hydroxymethyl)phenyl]-6-oxooctanoic acid.
| Compound Name | 2-butyl-8-[4-hydroxy-3-(hydroxymethyl)phenyl]-6-oxooctanoic acid |
|---|---|
| PubChem CID | 71109558 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-butyl-8-[4-hydroxy-3-(hydroxymethyl)phenyl]-6-oxooctanoic acid |
| SMILES | CCCCC(CCCC(=O)CCc1ccc(O)c(CO)c1)C(=O)O |
| InChI | InChI=1S/C19H28O5/c1-2-3-5-15(19(23)24)6-4-7-17(21)10-8-14-9-11-18(22)16(12-14)13-20/h9,11-12,15,20,22H,2-8,10,13H2,1H3,(H,23,24) |
| InChIKey | LFQLEZKMCLPEGK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |