C18H30O5 — CID 71109870
2-butyl-7-[4-hydroxy-3-(hydroxymethyl)phenyl]heptane-1,3,5-triol (PubChem CID 71109870) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-butyl-7-[4-hydroxy-3-(hydroxymethyl)phenyl]heptane-1,3,5-triol.
| Compound Name | 2-butyl-7-[4-hydroxy-3-(hydroxymethyl)phenyl]heptane-1,3,5-triol |
|---|---|
| PubChem CID | 71109870 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-butyl-7-[4-hydroxy-3-(hydroxymethyl)phenyl]heptane-1,3,5-triol |
| SMILES | CCCCC(CO)C(O)CC(O)CCc1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C18H30O5/c1-2-3-4-14(11-19)18(23)10-16(21)7-5-13-6-8-17(22)15(9-13)12-20/h6,8-9,14,16,18-23H,2-5,7,10-12H2,1H3 |
| InChIKey | WUBLYUQOLUPLMS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |