C13H16O4 — CID 58252619
6-[4-hydroxy-3-(hydroxymethyl)phenyl]hexane-2,4-dione (PubChem CID 58252619) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-[4-hydroxy-3-(hydroxymethyl)phenyl]hexane-2,4-dione.
| Compound Name | 6-[4-hydroxy-3-(hydroxymethyl)phenyl]hexane-2,4-dione |
|---|---|
| PubChem CID | 58252619 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 6-[4-hydroxy-3-(hydroxymethyl)phenyl]hexane-2,4-dione |
| SMILES | CC(=O)CC(=O)CCc1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C13H16O4/c1-9(15)6-12(16)4-2-10-3-5-13(17)11(7-10)8-14/h3,5,7,14,17H,2,4,6,8H2,1H3 |
| InChIKey | CHZMCXZILTZMLE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|