C16H22N2O7 — CID 91146124
5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate (PubChem CID 91146124) has the molecular formula C16H22N2O7 and a molecular weight of 354.36 g/mol. Its IUPAC name is 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate.
| Compound Name | 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate |
|---|---|
| PubChem CID | 91146124 |
| Molecular Formula | C16H22N2O7 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate |
| SMILES | COC(=O)C(N)CCC(=O)OC(=O)[C@@H](N)Cc1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C16H22N2O7/c1-24-15(22)11(17)3-5-14(21)25-16(23)12(18)7-9-2-4-13(20)10(6-9)8-19/h2,4,6,11-12,19-20H,3,5,7-8,17-18H2,1H3/t11?,12-/m0/s1 |
| InChIKey | MSOTZHGNUUYVFP-KIYNQFGBSA-N |
| XLogP | -0.90 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|