About 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate
5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate (PubChem CID 91146124) has the molecular formula C16H22N2O7
and a molecular weight of 354.36 g/mol. Its IUPAC name is 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate.
Molecular Properties
| Compound Name | 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate |
| PubChem CID | 91146124 |
| Molecular Formula | C16H22N2O7 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate |
| SMILES | COC(=O)C(N)CCC(=O)OC(=O)[C@@H](N)Cc1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C16H22N2O7/c1-24-15(22)11(17)3-5-14(21)25-16(23)12(18)7-9-2-4-13(20)10(6-9)8-19/h2,4,6,11-12,19-20H,3,5,7-8,17-18H2,1H3/t11?,12-/m0/s1 |
| InChIKey | MSOTZHGNUUYVFP-KIYNQFGBSA-N |
| XLogP | -0.90 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate?
The IUPAC name of 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate (CID 91146124) is 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate.
What is the SMILES notation for 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate?
The canonical SMILES for 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate is COC(=O)C(N)CCC(=O)OC(=O)[C@@H](N)Cc1ccc(O)c(CO)c1.
What is the InChIKey of 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate?
The InChIKey is MSOTZHGNUUYVFP-KIYNQFGBSA-N. The full InChI is InChI=1S/C16H22N2O7/c1-24-15(22)11(17)3-5-14(21)25-16(23)12(18)7-9-2-4-13(20)10(6-9)8-19/h2,4,6,11-12,19-20H,3,5,7-8,17-18H2,1H3/t11?,12-/m0/s1.
What are the key properties of 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate?
5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate has a molecular weight of 354.36 g/mol, XLogP of -0.90, 8 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-[(2S)-2-amino-3-[4-hydroxy-3-(hydroxymethyl)phenyl]propanoyl] 1-O-methyl 2-aminopentanedioate is sourced from PubChem (CID 91146124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).