C13H17NO3 — CID 89265273
N-[[4-hydroxy-3-(hydroxymethyl)phenyl]methyl]pent-4-enamide (PubChem CID 89265273) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-[[4-hydroxy-3-(hydroxymethyl)phenyl]methyl]pent-4-enamide.
| Compound Name | N-[[4-hydroxy-3-(hydroxymethyl)phenyl]methyl]pent-4-enamide |
|---|---|
| PubChem CID | 89265273 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[[4-hydroxy-3-(hydroxymethyl)phenyl]methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NCc1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C13H17NO3/c1-2-3-4-13(17)14-8-10-5-6-12(16)11(7-10)9-15/h2,5-7,15-16H,1,3-4,8-9H2,(H,14,17) |
| InChIKey | KLRZMSPCVKZURW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|